C27H39N — CID 135294770
(Z)-2-[7-[(Z)-but-1-enyl]-5-methyl-3-[(3E)-2,4,5-trimethylhepta-1,3-dien-3-yl]cyclohepta-1,3,6-trien-1-yl]-N-methylbut-2-en-1-imine (PubChem CID 135294770) has the molecular formula C27H39N and a molecular weight of 377.62 g/mol. Its IUPAC name is (Z)-2-[7-[(Z)-but-1-enyl]-5-methyl-3-[(3E)-2,4,5-trimethylhepta-1,3-dien-3-yl]cyclohepta-1,3,6-trien-1-yl]-N-methylbut-2-en-1-imine.
| Compound Name | (Z)-2-[7-[(Z)-but-1-enyl]-5-methyl-3-[(3E)-2,4,5-trimethylhepta-1,3-dien-3-yl]cyclohepta-1,3,6-trien-1-yl]-N-methylbut-2-en-1-imine |
|---|---|
| PubChem CID | 135294770 |
| Molecular Formula | C27H39N |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | (Z)-2-[7-[(Z)-but-1-enyl]-5-methyl-3-[(3E)-2,4,5-trimethylhepta-1,3-dien-3-yl]cyclohepta-1,3,6-trien-1-yl]-N-methylbut-2-en-1-imine |
| SMILES | C=C(C)/C(C1=CC(C)C=C(/C=C\CC)C(C(=C/C)/C=N/C)=C1)=C(/C)C(C)CC |
| InChI | InChI=1S/C27H39N/c1-10-13-14-24-15-20(6)16-25(17-26(24)23(12-3)18-28-9)27(19(4)5)22(8)21(7)11-2/h12-18,20-21H,4,10-11H2,1-3,5-9H3/b14-13-,23-12+,27-22+,28-18+ |
| InChIKey | MODXTYSEMGHIEG-IILNMLOTSA-N |
| XLogP | 7.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|