C22H38N2 — CID 123685297
N,N-diethyl-4-[[(2Z,5E)-8-methyl-5-prop-1-en-2-ylnona-2,5,7-trien-4-ylidene]amino]pentan-1-amine (PubChem CID 123685297) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is N,N-diethyl-4-[[(2Z,5E)-8-methyl-5-prop-1-en-2-ylnona-2,5,7-trien-4-ylidene]amino]pentan-1-amine.
| Compound Name | N,N-diethyl-4-[[(2Z,5E)-8-methyl-5-prop-1-en-2-ylnona-2,5,7-trien-4-ylidene]amino]pentan-1-amine |
|---|---|
| PubChem CID | 123685297 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | N,N-diethyl-4-[[(2Z,5E)-8-methyl-5-prop-1-en-2-ylnona-2,5,7-trien-4-ylidene]amino]pentan-1-amine |
| SMILES | C=C(C)C(=C\C=C(C)C)/C(/C=C\C)=N\C(C)CCCN(CC)CC |
| InChI | InChI=1S/C22H38N2/c1-9-13-22(21(19(6)7)16-15-18(4)5)23-20(8)14-12-17-24(10-2)11-3/h9,13,15-16,20H,6,10-12,14,17H2,1-5,7-8H3/b13-9-,21-16+,23-22- |
| InChIKey | YQTNWZXNCNINFL-WCUXBPNNSA-N |
| XLogP | 5.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|