C18H34N2 — CID 123858189
N-heptyl-N-methyl-2-methyliminonona-5,8-dien-1-amine (PubChem CID 123858189) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is N-heptyl-N-methyl-2-methyliminonona-5,8-dien-1-amine.
| Compound Name | N-heptyl-N-methyl-2-methyliminonona-5,8-dien-1-amine |
|---|---|
| PubChem CID | 123858189 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | N-heptyl-N-methyl-2-methyliminonona-5,8-dien-1-amine |
| SMILES | C=CCC=CCC/C(CN(C)CCCCCCC)=N\C |
| InChI | InChI=1S/C18H34N2/c1-5-7-9-11-13-15-18(19-3)17-20(4)16-14-12-10-8-6-2/h5,9,11H,1,6-8,10,12-17H2,2-4H3/b11-9?,19-18+ |
| InChIKey | RPUKLSJVGVAQSZ-UFAZBLEXSA-N |
| XLogP | 4.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|