About 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene
1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene (PubChem CID 66608809) has the molecular formula C20H36N2
and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene.
Molecular Properties
| Compound Name | 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene |
| PubChem CID | 66608809 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene |
| SMILES | C1=CCCCC(N2CCCCC/C=N\CCC2)CCCCC1 |
| InChI | InChI=1S/C20H36N2/c1-2-4-6-10-15-20(14-9-5-3-1)22-18-12-8-7-11-16-21-17-13-19-22/h1,3,16,20H,2,4-15,17-19H2/b3-1?,21-16- |
| InChIKey | UFKISRUNYJDSGU-MJTNQEMSSA-N |
| XLogP | 5.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene?
The IUPAC name of 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene (CID 66608809) is 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene.
What is the SMILES notation for 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene?
The canonical SMILES for 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene is C1=CCCCC(N2CCCCC/C=N\CCC2)CCCCC1.
What is the InChIKey of 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene?
The InChIKey is UFKISRUNYJDSGU-MJTNQEMSSA-N. The full InChI is InChI=1S/C20H36N2/c1-2-4-6-10-15-20(14-9-5-3-1)22-18-12-8-7-11-16-21-17-13-19-22/h1,3,16,20H,2,4-15,17-19H2/b3-1?,21-16-.
What are the key properties of 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene?
1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene has a molecular weight of 304.52 g/mol, XLogP of 5.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloundec-5-en-1-yl-1,5-diazacycloundec-5-ene is sourced from PubChem (CID 66608809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).