C45H84N2 — CID 118396905
6-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]imino-N,N-dimethylhexan-3-amine (PubChem CID 118396905) has the molecular formula C45H84N2 and a molecular weight of 653.18 g/mol. Its IUPAC name is 6-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]imino-N,N-dimethylhexan-3-amine.
| Compound Name | 6-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]imino-N,N-dimethylhexan-3-amine |
|---|---|
| PubChem CID | 118396905 |
| Molecular Formula | C45H84N2 |
| Molecular Weight | 653.18 g/mol |
| Exact Mass | 652.66 |
| IUPAC Name | 6-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]imino-N,N-dimethylhexan-3-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)/N=C/CCC(CC)N(C)C |
| InChI | InChI=1S/C45H84N2/c1-6-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40-44(46-43-39-42-45(8-3)47(4)5)41-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-7-2/h15-18,21-24,43-45H,6-14,19-20,25-42H2,1-5H3/b17-15-,18-16-,23-21-,24-22-,46-43+ |
| InChIKey | OVWZKKTUWICBOL-NNNLMRNLSA-N |
| XLogP | 14.95 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.18 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|