C20H36N2 — CID 66608808
1-[(5Z)-cycloundec-5-en-1-yl]-1,5-diazacycloundec-5-ene (PubChem CID 66608808) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-[(5Z)-cycloundec-5-en-1-yl]-1,5-diazacycloundec-5-ene.
| Compound Name | 1-[(5Z)-cycloundec-5-en-1-yl]-1,5-diazacycloundec-5-ene |
|---|---|
| PubChem CID | 66608808 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 1-[(5Z)-cycloundec-5-en-1-yl]-1,5-diazacycloundec-5-ene |
| SMILES | C1=C\CCCC(N2CCCCC/C=N\CCC2)CCCCC/1 |
| InChI | InChI=1S/C20H36N2/c1-2-4-6-10-15-20(14-9-5-3-1)22-18-12-8-7-11-16-21-17-13-19-22/h1,3,16,20H,2,4-15,17-19H2/b3-1-,21-16- |
| InChIKey | UFKISRUNYJDSGU-IMQLALEMSA-N |
| XLogP | 5.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|