C40H74N2+2 — CID 58954471
(2Z)-1-nonylidene-2-[2-[(2E)-1-nonylidene-1-azoniacycloundec-2-en-2-yl]ethyl]-1-azoniacycloundec-2-ene (PubChem CID 58954471) has the molecular formula C40H74N2+2 and a molecular weight of 583.05 g/mol. Its IUPAC name is (2Z)-1-nonylidene-2-[2-[(2E)-1-nonylidene-1-azoniacycloundec-2-en-2-yl]ethyl]-1-azoniacycloundec-2-ene.
| Compound Name | (2Z)-1-nonylidene-2-[2-[(2E)-1-nonylidene-1-azoniacycloundec-2-en-2-yl]ethyl]-1-azoniacycloundec-2-ene |
|---|---|
| PubChem CID | 58954471 |
| Molecular Formula | C40H74N2+2 |
| Molecular Weight | 583.05 g/mol |
| Exact Mass | 582.58 |
| IUPAC Name | (2Z)-1-nonylidene-2-[2-[(2E)-1-nonylidene-1-azoniacycloundec-2-en-2-yl]ethyl]-1-azoniacycloundec-2-ene |
| SMILES | CCCCCCCC/C=[N+]1CCCCCCCC/C=C\1CC/C1=C\CCCCCCCC\[N+]1=C/CCCCCCCC |
| InChI | InChI=1S/C40H74N2/c1-3-5-7-9-15-21-27-35-41-37-29-23-17-11-13-19-25-31-39(41)33-34-40-32-26-20-14-12-18-24-30-38-42(40)36-28-22-16-10-8-6-4-2/h31-32,35-36H,3-30,33-34,37-38H2,1-2H3/q+2/b39-31-,40-32+,41-35+,42-36+ |
| InChIKey | CTLCSBNIEWKHHA-GDQWEGHISA-N |
| XLogP | 12.69 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.05 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|