C20H37N2+ — CID 77274238
1-(cycloundecen-1-yl)-4-aza-1-azoniacycloundecene (PubChem CID 77274238) has the molecular formula C20H37N2+ and a molecular weight of 305.53 g/mol. Its IUPAC name is 1-(cycloundecen-1-yl)-4-aza-1-azoniacycloundecene.
| Compound Name | 1-(cycloundecen-1-yl)-4-aza-1-azoniacycloundecene |
|---|---|
| PubChem CID | 77274238 |
| Molecular Formula | C20H37N2+ |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.30 |
| IUPAC Name | 1-(cycloundecen-1-yl)-4-aza-1-azoniacycloundecene |
| SMILES | C1=C(/[N+]2=C/CNCCCCCCC2)CCCCCCCCC1 |
| InChI | InChI=1S/C20H37N2/c1-2-4-7-11-15-20(14-10-6-3-1)22-18-13-9-5-8-12-16-21-17-19-22/h14,19,21H,1-13,15-18H2/q+1/b20-14?,22-19+ |
| InChIKey | NVSBIMGHBWXLCZ-HAPBUICKSA-N |
| XLogP | 5.03 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|