C40H77N2+ — CID 59858142
(E)-N-[3-[(2Z)-1-nonylidene-1-azoniacycloundec-2-en-2-yl]propyl]octadec-9-en-1-amine (PubChem CID 59858142) has the molecular formula C40H77N2+ and a molecular weight of 586.07 g/mol. Its IUPAC name is (E)-N-[3-[(2Z)-1-nonylidene-1-azoniacycloundec-2-en-2-yl]propyl]octadec-9-en-1-amine.
| Compound Name | (E)-N-[3-[(2Z)-1-nonylidene-1-azoniacycloundec-2-en-2-yl]propyl]octadec-9-en-1-amine |
|---|---|
| PubChem CID | 59858142 |
| Molecular Formula | C40H77N2+ |
| Molecular Weight | 586.07 g/mol |
| Exact Mass | 585.61 |
| IUPAC Name | (E)-N-[3-[(2Z)-1-nonylidene-1-azoniacycloundec-2-en-2-yl]propyl]octadec-9-en-1-amine |
| SMILES | CCCCCCCC/C=C/CCCCCCCCNCCC/C1=C/CCCCCCCC\[N+]1=C/CCCCCCCC |
| InChI | InChI=1S/C40H77N2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-22-26-30-36-41-37-33-35-40-34-29-25-21-20-24-28-32-39-42(40)38-31-27-23-10-8-6-4-2/h14-15,34,38,41H,3-13,16-33,35-37,39H2,1-2H3/q+1/b15-14+,40-34-,42-38+ |
| InChIKey | QCNPRBHJSSKKBO-BGWRFUGPSA-N |
| XLogP | 12.86 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.07 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|