C26H40N2 — CID 122582714
(3Z,5Z)-N-[(5Z,7Z)-12-[[(2Z,4Z)-2-methylhexa-2,4-dienylidene]amino]dodeca-5,7-dienyl]hepta-3,5-dien-2-imine (PubChem CID 122582714) has the molecular formula C26H40N2 and a molecular weight of 380.62 g/mol. Its IUPAC name is (3Z,5Z)-N-[(5Z,7Z)-12-[[(2Z,4Z)-2-methylhexa-2,4-dienylidene]amino]dodeca-5,7-dienyl]hepta-3,5-dien-2-imine.
| Compound Name | (3Z,5Z)-N-[(5Z,7Z)-12-[[(2Z,4Z)-2-methylhexa-2,4-dienylidene]amino]dodeca-5,7-dienyl]hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 122582714 |
| Molecular Formula | C26H40N2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.32 |
| IUPAC Name | (3Z,5Z)-N-[(5Z,7Z)-12-[[(2Z,4Z)-2-methylhexa-2,4-dienylidene]amino]dodeca-5,7-dienyl]hepta-3,5-dien-2-imine |
| SMILES | C/C=C\C=C/C(C)=N/CCCC/C=C\C=C/CCCC/N=C/C(C)=C\C=C/C |
| InChI | InChI=1S/C26H40N2/c1-5-7-17-21-26(4)28-23-19-16-14-12-10-9-11-13-15-18-22-27-24-25(3)20-8-6-2/h5-12,17,20-21,24H,13-16,18-19,22-23H2,1-4H3/b7-5-,8-6-,11-9-,12-10-,21-17-,25-20-,27-24+,28-26+ |
| InChIKey | QLOLMDUOGRWZPU-URGOXPILSA-N |
| XLogP | 7.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|