C13H24N2 — CID 91067055
(Z)-4-N-hexyl-1-N,2-dimethylpent-2-ene-1,4-diimine (PubChem CID 91067055) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (Z)-4-N-hexyl-1-N,2-dimethylpent-2-ene-1,4-diimine.
| Compound Name | (Z)-4-N-hexyl-1-N,2-dimethylpent-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 91067055 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (Z)-4-N-hexyl-1-N,2-dimethylpent-2-ene-1,4-diimine |
| SMILES | CCCCCC/N=C(C)/C=C(C)\C=N\C |
| InChI | InChI=1S/C13H24N2/c1-5-6-7-8-9-15-13(3)10-12(2)11-14-4/h10-11H,5-9H2,1-4H3/b12-10-,14-11+,15-13+ |
| InChIKey | CCMJDBZVLGRONN-BGZABPNLSA-N |
| XLogP | 3.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|