About 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine
6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine (PubChem CID 135038641) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine.
Analyze 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine?
The IUPAC name of 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine (CID 135038641) is 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine.
What is the SMILES notation for 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine?
The canonical SMILES for 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine is C/C=C(\C)C1=NCCCC1.
What is the InChIKey of 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine?
The InChIKey is HKILPPJUSIAPMB-FPYGCLRLSA-N. The full InChI is InChI=1S/C9H15N/c1-3-8(2)9-6-4-5-7-10-9/h3H,4-7H2,1-2H3/b8-3+.
What are the key properties of 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine?
6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine has a molecular weight of 137.23 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-but-2-en-2-yl]-2,3,4,5-tetrahydropyridine is sourced from PubChem (CID 135038641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).