C12H18N2 — CID 90957874
3-ethenyl-1-N,4-N-dimethylocta-2,5-diene-1,4-diimine (PubChem CID 90957874) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-ethenyl-1-N,4-N-dimethylocta-2,5-diene-1,4-diimine.
| Compound Name | 3-ethenyl-1-N,4-N-dimethylocta-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 90957874 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 3-ethenyl-1-N,4-N-dimethylocta-2,5-diene-1,4-diimine |
| SMILES | C=CC(=C/C=N/C)/C(C=CCC)=N/C |
| InChI | InChI=1S/C12H18N2/c1-5-7-8-12(14-4)11(6-2)9-10-13-3/h6-10H,2,5H2,1,3-4H3/b8-7?,11-9?,13-10+,14-12+ |
| InChIKey | NFGMFFXPLAALOJ-DTFUOQQZSA-N |
| XLogP | 2.84 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|