C10H16FN — CID 169104905
(4Z)-2-fluoro-N,2,6-trimethylhepta-4,6-dien-3-imine (PubChem CID 169104905) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is (4Z)-2-fluoro-N,2,6-trimethylhepta-4,6-dien-3-imine.
| Compound Name | (4Z)-2-fluoro-N,2,6-trimethylhepta-4,6-dien-3-imine |
|---|---|
| PubChem CID | 169104905 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (4Z)-2-fluoro-N,2,6-trimethylhepta-4,6-dien-3-imine |
| SMILES | C=C(C)/C=C\C(=N\C)C(C)(C)F |
| InChI | InChI=1S/C10H16FN/c1-8(2)6-7-9(12-5)10(3,4)11/h6-7H,1H2,2-5H3/b7-6-,12-9- |
| InChIKey | CDQDPOXHEOMNLG-OMBMMOEUSA-N |
| XLogP | 2.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|