C13H18FN — CID 126592408
(3E,6Z)-9-ethenyl-4-fluoro-2,6,8-trimethyl-5,8-dihydro-2H-azonine (PubChem CID 126592408) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is (3E,6Z)-9-ethenyl-4-fluoro-2,6,8-trimethyl-5,8-dihydro-2H-azonine.
| Compound Name | (3E,6Z)-9-ethenyl-4-fluoro-2,6,8-trimethyl-5,8-dihydro-2H-azonine |
|---|---|
| PubChem CID | 126592408 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (3E,6Z)-9-ethenyl-4-fluoro-2,6,8-trimethyl-5,8-dihydro-2H-azonine |
| SMILES | C=C/C1=N/C(C)/C=C(/F)C/C(C)=C\C1C |
| InChI | InChI=1S/C13H18FN/c1-5-13-10(3)6-9(2)7-12(14)8-11(4)15-13/h5-6,8,10-11H,1,7H2,2-4H3/b9-6-,12-8+,15-13- |
| InChIKey | GHLIWSMQJROWID-YNKQAZBPSA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|