C11H18FN — CID 153392502
(4E)-6-fluoro-N,2,5,6-tetramethylhepta-1,4-dien-3-imine (PubChem CID 153392502) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is (4E)-6-fluoro-N,2,5,6-tetramethylhepta-1,4-dien-3-imine.
| Compound Name | (4E)-6-fluoro-N,2,5,6-tetramethylhepta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 153392502 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (4E)-6-fluoro-N,2,5,6-tetramethylhepta-1,4-dien-3-imine |
| SMILES | C=C(C)C(/C=C(\C)C(C)(C)F)=N\C |
| InChI | InChI=1S/C11H18FN/c1-8(2)10(13-6)7-9(3)11(4,5)12/h7H,1H2,2-6H3/b9-7+,13-10- |
| InChIKey | QCKJWISYSMRMPX-KCOVVYJESA-N |
| XLogP | 3.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|