C13H14FN — CID 91172116
7-fluoro-3-methyl-2-prop-1-enyl-2,3-dihydroquinoline (PubChem CID 91172116) has the molecular formula C13H14FN and a molecular weight of 203.26 g/mol. Its IUPAC name is 7-fluoro-3-methyl-2-prop-1-enyl-2,3-dihydroquinoline.
| Compound Name | 7-fluoro-3-methyl-2-prop-1-enyl-2,3-dihydroquinoline |
|---|---|
| PubChem CID | 91172116 |
| Molecular Formula | C13H14FN |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 7-fluoro-3-methyl-2-prop-1-enyl-2,3-dihydroquinoline |
| SMILES | CC=CC1N=c2cc(F)ccc2=CC1C |
| InChI | InChI=1S/C13H14FN/c1-3-4-12-9(2)7-10-5-6-11(14)8-13(10)15-12/h3-9,12H,1-2H3 |
| InChIKey | TZOKPUSBVONRNH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|