C20H34N2 — CID 144683552
(4E)-4-[4,5-dimethyl-1-(3-propylhex-5-en-2-yl)-3H-pyrrol-2-ylidene]-N-methylbutan-1-imine (PubChem CID 144683552) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is (4E)-4-[4,5-dimethyl-1-(3-propylhex-5-en-2-yl)-3H-pyrrol-2-ylidene]-N-methylbutan-1-imine.
| Compound Name | (4E)-4-[4,5-dimethyl-1-(3-propylhex-5-en-2-yl)-3H-pyrrol-2-ylidene]-N-methylbutan-1-imine |
|---|---|
| PubChem CID | 144683552 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | (4E)-4-[4,5-dimethyl-1-(3-propylhex-5-en-2-yl)-3H-pyrrol-2-ylidene]-N-methylbutan-1-imine |
| SMILES | C=CCC(CCC)C(C)N1C(C)=C(C)C/C1=C\CC/C=N/C |
| InChI | InChI=1S/C20H34N2/c1-7-11-19(12-8-2)18(5)22-17(4)16(3)15-20(22)13-9-10-14-21-6/h7,13-14,18-19H,1,8-12,15H2,2-6H3/b20-13+,21-14+ |
| InChIKey | NMRCFBDMMJSCSB-KVVJQUGZSA-N |
| XLogP | 5.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|