C29H54N2 — CID 123241621
N,3,8-trimethyl-N-[7-(2-methyl-3-methylideneheptyl)iminooct-2-en-2-yl]non-7-en-1-amine (PubChem CID 123241621) has the molecular formula C29H54N2 and a molecular weight of 430.77 g/mol. Its IUPAC name is N,3,8-trimethyl-N-[7-(2-methyl-3-methylideneheptyl)iminooct-2-en-2-yl]non-7-en-1-amine.
| Compound Name | N,3,8-trimethyl-N-[7-(2-methyl-3-methylideneheptyl)iminooct-2-en-2-yl]non-7-en-1-amine |
|---|---|
| PubChem CID | 123241621 |
| Molecular Formula | C29H54N2 |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 430.43 |
| IUPAC Name | N,3,8-trimethyl-N-[7-(2-methyl-3-methylideneheptyl)iminooct-2-en-2-yl]non-7-en-1-amine |
| SMILES | C=C(CCCC)C(C)C/N=C(\C)CCCC=C(C)N(C)CCC(C)CCCC=C(C)C |
| InChI | InChI=1S/C29H54N2/c1-10-11-18-26(5)27(6)23-30-28(7)19-14-15-20-29(8)31(9)22-21-25(4)17-13-12-16-24(2)3/h16,20,25,27H,5,10-15,17-19,21-23H2,1-4,6-9H3/b29-20?,30-28+ |
| InChIKey | VTVSNDPAGPZZDN-VBZWJBBYSA-N |
| XLogP | 9.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|