C16H29N2+ — CID 123274994
1-(5-ethyl-6,7-dimethyl-2-methylidene-4,5-dihydro-3H-azepin-1-yl)propan-2-ylidene-dimethylazanium (PubChem CID 123274994) has the molecular formula C16H29N2+ and a molecular weight of 249.42 g/mol. Its IUPAC name is 1-(5-ethyl-6,7-dimethyl-2-methylidene-4,5-dihydro-3H-azepin-1-yl)propan-2-ylidene-dimethylazanium.
| Compound Name | 1-(5-ethyl-6,7-dimethyl-2-methylidene-4,5-dihydro-3H-azepin-1-yl)propan-2-ylidene-dimethylazanium |
|---|---|
| PubChem CID | 123274994 |
| Molecular Formula | C16H29N2+ |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.23 |
| IUPAC Name | 1-(5-ethyl-6,7-dimethyl-2-methylidene-4,5-dihydro-3H-azepin-1-yl)propan-2-ylidene-dimethylazanium |
| SMILES | C=C1CCC(CC)C(C)=C(C)N1CC(C)=[N+](C)C |
| InChI | InChI=1S/C16H29N2/c1-8-16-10-9-12(2)18(15(5)14(16)4)11-13(3)17(6)7/h16H,2,8-11H2,1,3-7H3/q+1 |
| InChIKey | IMLDXGBIRYXLFK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|