C30H51N2+ — CID 91131011
N,N-diethyl-4-[6-[1-(4-heptylcyclohex-2-en-1-yl)ethylimino]-3-methylcyclohex-2-en-1-yl]but-1-en-2-amine (PubChem CID 91131011) has the molecular formula C30H51N2+ and a molecular weight of 439.75 g/mol. Its IUPAC name is N,N-diethyl-4-[6-[1-(4-heptylcyclohex-2-en-1-yl)ethylimino]-3-methylcyclohex-2-en-1-yl]but-1-en-2-amine.
| Compound Name | N,N-diethyl-4-[6-[1-(4-heptylcyclohex-2-en-1-yl)ethylimino]-3-methylcyclohex-2-en-1-yl]but-1-en-2-amine |
|---|---|
| PubChem CID | 91131011 |
| Molecular Formula | C30H51N2+ |
| Molecular Weight | 439.75 g/mol |
| Exact Mass | 439.40 |
| IUPAC Name | N,N-diethyl-4-[6-[1-(4-heptylcyclohex-2-en-1-yl)ethylimino]-3-methylcyclohex-2-en-1-yl]but-1-en-2-amine |
| SMILES | C=C(CCC1C=C(C)CC/C1=N/C(C)C1C=CC(CCCCCCC)C[CH+]1)N(CC)CC |
| InChI | InChI=1S/C30H51N2/c1-7-10-11-12-13-14-27-17-20-28(21-18-27)26(6)31-30-22-15-24(4)23-29(30)19-16-25(5)32(8-2)9-3/h17,20-21,23,26-29H,5,7-16,18-19,22H2,1-4,6H3/q+1/b31-30- |
| InChIKey | BJTTWUITUULUJH-KTMFPKCZSA-N |
| XLogP | 8.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.75 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|