C21H35N3 — CID 141065261
[6-ethyl-2-[1-(5-methylhexan-2-yl)piperidin-4-yl]cyclohex-3-en-1-ylidene]cyanamide (PubChem CID 141065261) has the molecular formula C21H35N3 and a molecular weight of 329.53 g/mol. Its IUPAC name is [6-ethyl-2-[1-(5-methylhexan-2-yl)piperidin-4-yl]cyclohex-3-en-1-ylidene]cyanamide.
| Compound Name | [6-ethyl-2-[1-(5-methylhexan-2-yl)piperidin-4-yl]cyclohex-3-en-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 141065261 |
| Molecular Formula | C21H35N3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | [6-ethyl-2-[1-(5-methylhexan-2-yl)piperidin-4-yl]cyclohex-3-en-1-ylidene]cyanamide |
| SMILES | CCC1CC=CC(C2CCN(C(C)CCC(C)C)CC2)/C1=N/C#N |
| InChI | InChI=1S/C21H35N3/c1-5-18-7-6-8-20(21(18)23-15-22)19-11-13-24(14-12-19)17(4)10-9-16(2)3/h6,8,16-20H,5,7,9-14H2,1-4H3/b23-21+ |
| InChIKey | LPTBQUFRJKQULX-XTQSDGFTSA-N |
| XLogP | 5.05 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|