C14H25N3 — CID 123984515
N,N-dimethyl-2-(7-methylimino-2,3,4,4a,8,8a-hexahydroquinolin-1-yl)ethanamine (PubChem CID 123984515) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N,N-dimethyl-2-(7-methylimino-2,3,4,4a,8,8a-hexahydroquinolin-1-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(7-methylimino-2,3,4,4a,8,8a-hexahydroquinolin-1-yl)ethanamine |
|---|---|
| PubChem CID | 123984515 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N,N-dimethyl-2-(7-methylimino-2,3,4,4a,8,8a-hexahydroquinolin-1-yl)ethanamine |
| SMILES | C/N=C1\C=CC2CCCN(CCN(C)C)C2C1 |
| InChI | InChI=1S/C14H25N3/c1-15-13-7-6-12-5-4-8-17(14(12)11-13)10-9-16(2)3/h6-7,12,14H,4-5,8-11H2,1-3H3/b15-13+ |
| InChIKey | LZJLBYSWBZFDTJ-FYWRMAATSA-N |
| XLogP | 1.66 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|