C15H29N3 — CID 158236843
(4aR,7Z)-7-ethylidene-N-methyl-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-6-imine;azane (PubChem CID 158236843) has the molecular formula C15H29N3 and a molecular weight of 251.42 g/mol. Its IUPAC name is (4aR,7Z)-7-ethylidene-N-methyl-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-6-imine;azane.
| Compound Name | (4aR,7Z)-7-ethylidene-N-methyl-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-6-imine;azane |
|---|---|
| PubChem CID | 158236843 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | (4aR,7Z)-7-ethylidene-N-methyl-1-propyl-3,4,4a,5,8,8a-hexahydro-2H-quinolin-6-imine;azane |
| SMILES | C/C=C1/CC2[C@H](CCCN2CCC)C/C1=N\C.N |
| InChI | InChI=1S/C15H26N2.H3N/c1-4-8-17-9-6-7-13-10-14(16-3)12(5-2)11-15(13)17;/h5,13,15H,4,6-11H2,1-3H3;1H3/b12-5-,16-14+;/t13-,15?;/m1./s1 |
| InChIKey | QGJAPGPQIZNEIZ-NVTHHSBBSA-N |
| XLogP | 3.45 |
| TPSA | 50.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|