C15H22N2 — CID 163106954
(1S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene (PubChem CID 163106954) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (1S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene.
| Compound Name | (1S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene |
|---|---|
| PubChem CID | 163106954 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (1S,9S,10R)-3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene |
| SMILES | C1=C2CCCN=C2[C@H]2C[C@@H]1[C@H]1CCCCN1C2 |
| InChI | InChI=1S/C15H22N2/c1-2-7-17-10-13-9-12(14(17)5-1)8-11-4-3-6-16-15(11)13/h8,12-14H,1-7,9-10H2/t12-,13+,14-/m1/s1 |
| InChIKey | ZVLHOJXCGOUVOP-HZSPNIEDSA-N |
| XLogP | 2.65 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |