About 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene
3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene (PubChem CID 163106953) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene.
Analyze 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene?
The IUPAC name of 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene (CID 163106953) is 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene.
What is the SMILES notation for 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene?
The canonical SMILES for 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene is C1=C2CCCN=C2C2CC1C1CCCCN1C2.
What is the InChIKey of 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene?
The InChIKey is ZVLHOJXCGOUVOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2/c1-2-7-17-10-13-9-12(14(17)5-1)8-11-4-3-6-16-15(11)13/h8,12-14H,1-7,9-10H2.
What are the key properties of 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene?
3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene has a molecular weight of 230.35 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,7-diene is sourced from PubChem (CID 163106953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).