C18H28N2 — CID 90983086
2-(3-methylhex-5-en-2-yl)-1,3,3a,7,8,8a,9,9a-octahydropyrrolo[3,4-b]quinoline (PubChem CID 90983086) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2-(3-methylhex-5-en-2-yl)-1,3,3a,7,8,8a,9,9a-octahydropyrrolo[3,4-b]quinoline.
| Compound Name | 2-(3-methylhex-5-en-2-yl)-1,3,3a,7,8,8a,9,9a-octahydropyrrolo[3,4-b]quinoline |
|---|---|
| PubChem CID | 90983086 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2-(3-methylhex-5-en-2-yl)-1,3,3a,7,8,8a,9,9a-octahydropyrrolo[3,4-b]quinoline |
| SMILES | C=CCC(C)C(C)N1CC2CC3CCC=CC3=NC2C1 |
| InChI | InChI=1S/C18H28N2/c1-4-7-13(2)14(3)20-11-16-10-15-8-5-6-9-17(15)19-18(16)12-20/h4,6,9,13-16,18H,1,5,7-8,10-12H2,2-3H3 |
| InChIKey | QJSKVZZTRXCPQH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|