C27H46N2 — CID 88900542
N-[5-[(2R)-1-(4-tert-butylcyclohex-2-en-1-yl)pyrrolidin-2-yl]-2-propylcyclohex-3-en-1-yl]butan-2-imine (PubChem CID 88900542) has the molecular formula C27H46N2 and a molecular weight of 398.68 g/mol. Its IUPAC name is N-[5-[(2R)-1-(4-tert-butylcyclohex-2-en-1-yl)pyrrolidin-2-yl]-2-propylcyclohex-3-en-1-yl]butan-2-imine.
| Compound Name | N-[5-[(2R)-1-(4-tert-butylcyclohex-2-en-1-yl)pyrrolidin-2-yl]-2-propylcyclohex-3-en-1-yl]butan-2-imine |
|---|---|
| PubChem CID | 88900542 |
| Molecular Formula | C27H46N2 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.37 |
| IUPAC Name | N-[5-[(2R)-1-(4-tert-butylcyclohex-2-en-1-yl)pyrrolidin-2-yl]-2-propylcyclohex-3-en-1-yl]butan-2-imine |
| SMILES | CCCC1C=CC([C@H]2CCCN2C2C=CC(C(C)(C)C)CC2)CC1/N=C(\C)CC |
| InChI | InChI=1S/C27H46N2/c1-7-10-21-12-13-22(19-25(21)28-20(3)8-2)26-11-9-18-29(26)24-16-14-23(15-17-24)27(4,5)6/h12-14,16,21-26H,7-11,15,17-19H2,1-6H3/b28-20+/t21?,22?,23?,24?,25?,26-/m1/s1 |
| InChIKey | VBMJTAMULLLAAK-GFBXIHGYSA-N |
| XLogP | 7.06 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|