C34H52N2 — CID 123173713
N-but-2-en-2-yl-N,7,12-trimethyl-3-[1-(2-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethylidene]-4-prop-1-enylhexadeca-1,4,7,9,14-pentaen-8-amine (PubChem CID 123173713) has the molecular formula C34H52N2 and a molecular weight of 488.80 g/mol. Its IUPAC name is N-but-2-en-2-yl-N,7,12-trimethyl-3-[1-(2-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethylidene]-4-prop-1-enylhexadeca-1,4,7,9,14-pentaen-8-amine.
| Compound Name | N-but-2-en-2-yl-N,7,12-trimethyl-3-[1-(2-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethylidene]-4-prop-1-enylhexadeca-1,4,7,9,14-pentaen-8-amine |
|---|---|
| PubChem CID | 123173713 |
| Molecular Formula | C34H52N2 |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 488.41 |
| IUPAC Name | N-but-2-en-2-yl-N,7,12-trimethyl-3-[1-(2-methyl-2,3,4,5-tetrahydropyridin-6-yl)ethylidene]-4-prop-1-enylhexadeca-1,4,7,9,14-pentaen-8-amine |
| SMILES | C=CC(C(C=CC)=CCC(C)=C(C=CCC(C)CC=CC)N(C)C(C)=CC)=C(C)C1=NC(C)CCC1 |
| InChI | InChI=1S/C34H52N2/c1-11-15-19-26(5)20-16-23-34(36(10)29(8)13-3)27(6)24-25-31(18-12-2)32(14-4)30(9)33-22-17-21-28(7)35-33/h11-16,18,23,25-26,28H,4,17,19-22,24H2,1-3,5-10H3 |
| InChIKey | LYCSBNVOZWXDSO-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|