C43H81N3 — CID 168879557
9-[(Z)-but-2-en-2-yl]imino-8-N,8-N-di(nonyl)undec-10-ene-1,8-diamine;(3Z,5E)-2,6-dimethylocta-1,3,5-triene (PubChem CID 168879557) has the molecular formula C43H81N3 and a molecular weight of 640.14 g/mol. Its IUPAC name is 9-[(Z)-but-2-en-2-yl]imino-8-N,8-N-di(nonyl)undec-10-ene-1,8-diamine;(3Z,5E)-2,6-dimethylocta-1,3,5-triene.
| Compound Name | 9-[(Z)-but-2-en-2-yl]imino-8-N,8-N-di(nonyl)undec-10-ene-1,8-diamine;(3Z,5E)-2,6-dimethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 168879557 |
| Molecular Formula | C43H81N3 |
| Molecular Weight | 640.14 g/mol |
| Exact Mass | 639.64 |
| IUPAC Name | 9-[(Z)-but-2-en-2-yl]imino-8-N,8-N-di(nonyl)undec-10-ene-1,8-diamine;(3Z,5E)-2,6-dimethylocta-1,3,5-triene |
| SMILES | C=C(C)/C=C\C=C(/C)CC.C=C/C(=N\C(C)=C/C)C(CCCCCCCN)N(CCCCCCCCC)CCCCCCCCC |
| InChI | InChI=1S/C33H65N3.C10H16/c1-6-10-12-14-16-21-25-29-36(30-26-22-17-15-13-11-7-2)33(27-23-19-18-20-24-28-34)32(9-4)35-31(5)8-3;1-5-10(4)8-6-7-9(2)3/h8-9,33H,4,6-7,10-30,34H2,1-3,5H3;6-8H,2,5H2,1,3-4H3/b31-8-,35-32+;7-6-,10-8+ |
| InChIKey | NEMPCQNHGLCTQS-GPKBVMKXSA-N |
| XLogP | 13.48 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.14 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|