C21H46N4O4 — CID 87338408
(2S)-2-aminopropanoic acid;2-[bis(2-aminoethyl)amino]tetradecanoic acid (PubChem CID 87338408) has the molecular formula C21H46N4O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;2-[bis(2-aminoethyl)amino]tetradecanoic acid.
| Compound Name | (2S)-2-aminopropanoic acid;2-[bis(2-aminoethyl)amino]tetradecanoic acid |
|---|---|
| PubChem CID | 87338408 |
| Molecular Formula | C21H46N4O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.35 |
| IUPAC Name | (2S)-2-aminopropanoic acid;2-[bis(2-aminoethyl)amino]tetradecanoic acid |
| SMILES | CCCCCCCCCCCCC(C(=O)O)N(CCN)CCN.C[C@H](N)C(=O)O |
| InChI | InChI=1S/C18H39N3O2.C3H7NO2/c1-2-3-4-5-6-7-8-9-10-11-12-17(18(22)23)21(15-13-19)16-14-20;1-2(4)3(5)6/h17H,2-16,19-20H2,1H3,(H,22,23);2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | SLFOTBCYUWRYBW-WNQIDUERSA-N |
| XLogP | 2.39 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|