C21H39N2+ — CID 123249569
[1-[4-(ethylamino)cyclohex-3-en-1-yl]-4-methylpentan-3-ylidene]-methyl-(4-methylpent-1-en-2-yl)azanium (PubChem CID 123249569) has the molecular formula C21H39N2+ and a molecular weight of 319.56 g/mol. Its IUPAC name is [1-[4-(ethylamino)cyclohex-3-en-1-yl]-4-methylpentan-3-ylidene]-methyl-(4-methylpent-1-en-2-yl)azanium.
| Compound Name | [1-[4-(ethylamino)cyclohex-3-en-1-yl]-4-methylpentan-3-ylidene]-methyl-(4-methylpent-1-en-2-yl)azanium |
|---|---|
| PubChem CID | 123249569 |
| Molecular Formula | C21H39N2+ |
| Molecular Weight | 319.56 g/mol |
| Exact Mass | 319.31 |
| IUPAC Name | [1-[4-(ethylamino)cyclohex-3-en-1-yl]-4-methylpentan-3-ylidene]-methyl-(4-methylpent-1-en-2-yl)azanium |
| SMILES | C=C(CC(C)C)/[N+](C)=C(/CCC1CC=C(NCC)CC1)C(C)C |
| InChI | InChI=1S/C21H39N2/c1-8-22-20-12-9-19(10-13-20)11-14-21(17(4)5)23(7)18(6)15-16(2)3/h12,16-17,19,22H,6,8-11,13-15H2,1-5,7H3/q+1/b23-21- |
| InChIKey | ZTHVEQDTDSSLMB-LNVKXUELSA-N |
| XLogP | 5.36 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|