C18H36N2 — CID 138632933
(E,7R,9S)-13-imino-N,2,9-trimethylpentadec-4-en-7-amine (PubChem CID 138632933) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is (E,7R,9S)-13-imino-N,2,9-trimethylpentadec-4-en-7-amine.
| Compound Name | (E,7R,9S)-13-imino-N,2,9-trimethylpentadec-4-en-7-amine |
|---|---|
| PubChem CID | 138632933 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | (E,7R,9S)-13-imino-N,2,9-trimethylpentadec-4-en-7-amine |
| SMILES | [H]/N=C(\CC)CCC[C@H](C)C[C@H](C/C=C/CC(C)C)NC |
| InChI | InChI=1S/C18H36N2/c1-6-17(19)12-9-11-16(4)14-18(20-5)13-8-7-10-15(2)3/h7-8,15-16,18-20H,6,9-14H2,1-5H3/b8-7+,19-17+/t16-,18-/m0/s1 |
| InChIKey | DFIXYNOWDSAPRT-YMGJFFJHSA-N |
| XLogP | 5.19 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|