C16H30N2 — CID 143440305
N-[(E)-5-methyl-4-methyliminooct-2-en-2-yl]cyclohexanamine (PubChem CID 143440305) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is N-[(E)-5-methyl-4-methyliminooct-2-en-2-yl]cyclohexanamine.
| Compound Name | N-[(E)-5-methyl-4-methyliminooct-2-en-2-yl]cyclohexanamine |
|---|---|
| PubChem CID | 143440305 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | N-[(E)-5-methyl-4-methyliminooct-2-en-2-yl]cyclohexanamine |
| SMILES | CCCC(C)C(/C=C(\C)NC1CCCCC1)=N\C |
| InChI | InChI=1S/C16H30N2/c1-5-9-13(2)16(17-4)12-14(3)18-15-10-7-6-8-11-15/h12-13,15,18H,5-11H2,1-4H3/b14-12+,17-16- |
| InChIKey | OWDFMBAYTWHXBF-JVCJPLAKSA-N |
| XLogP | 4.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|