C12H21N2+ — CID 123902353
(4-ethyl-3,6-dimethyl-3,4-dihydropyridin-2-yl)methyl-methyl-methylideneazanium (PubChem CID 123902353) has the molecular formula C12H21N2+ and a molecular weight of 193.31 g/mol. Its IUPAC name is (4-ethyl-3,6-dimethyl-3,4-dihydropyridin-2-yl)methyl-methyl-methylideneazanium.
| Compound Name | (4-ethyl-3,6-dimethyl-3,4-dihydropyridin-2-yl)methyl-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123902353 |
| Molecular Formula | C12H21N2+ |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.17 |
| IUPAC Name | (4-ethyl-3,6-dimethyl-3,4-dihydropyridin-2-yl)methyl-methyl-methylideneazanium |
| SMILES | C=[N+](C)CC1=NC(C)=CC(CC)C1C |
| InChI | InChI=1S/C12H21N2/c1-6-11-7-9(2)13-12(10(11)3)8-14(4)5/h7,10-11H,4,6,8H2,1-3,5H3/q+1 |
| InChIKey | CFIXNAXSEZFASB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|