C13H25N2+ — CID 123383668
N,N-dimethyl-2-(1,3,7-trimethyl-4,5-dihydro-3H-azepin-1-ium-4-yl)ethanamine (PubChem CID 123383668) has the molecular formula C13H25N2+ and a molecular weight of 209.36 g/mol. Its IUPAC name is N,N-dimethyl-2-(1,3,7-trimethyl-4,5-dihydro-3H-azepin-1-ium-4-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(1,3,7-trimethyl-4,5-dihydro-3H-azepin-1-ium-4-yl)ethanamine |
|---|---|
| PubChem CID | 123383668 |
| Molecular Formula | C13H25N2+ |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.20 |
| IUPAC Name | N,N-dimethyl-2-(1,3,7-trimethyl-4,5-dihydro-3H-azepin-1-ium-4-yl)ethanamine |
| SMILES | CC1=CCC(CCN(C)C)C(C)C=[N+]1C |
| InChI | InChI=1S/C13H25N2/c1-11-10-15(5)12(2)6-7-13(11)8-9-14(3)4/h6,10-11,13H,7-9H2,1-5H3/q+1 |
| InChIKey | ZNXUXSMVOUZNFT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|