About ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine
ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine (PubChem CID 145197743) has the molecular formula C16H31FN2
and a molecular weight of 270.44 g/mol. Its IUPAC name is ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine.
Molecular Properties
| Compound Name | ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine |
| PubChem CID | 145197743 |
| Molecular Formula | C16H31FN2 |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.25 |
| IUPAC Name | ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine |
| SMILES | CC.CC.CC1=CCCC(CN2CCC(F)C2)C=N1 |
| InChI | InChI=1S/C12H19FN2.2C2H6/c1-10-3-2-4-11(7-14-10)8-15-6-5-12(13)9-15;2*1-2/h3,7,11-12H,2,4-6,8-9H2,1H3;2*1-2H3 |
| InChIKey | BWWPCMDGERWJNF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine?
The IUPAC name of ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine (CID 145197743) is ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine.
What is the SMILES notation for ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine?
The canonical SMILES for ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine is CC.CC.CC1=CCCC(CN2CCC(F)C2)C=N1.
What is the InChIKey of ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine?
The InChIKey is BWWPCMDGERWJNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19FN2.2C2H6/c1-10-3-2-4-11(7-14-10)8-15-6-5-12(13)9-15;2*1-2/h3,7,11-12H,2,4-6,8-9H2,1H3;2*1-2H3.
What are the key properties of ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine?
ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine has a molecular weight of 270.44 g/mol, XLogP of 4.47, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[(3-fluoropyrrolidin-1-yl)methyl]-7-methyl-4,5-dihydro-3H-azepine is sourced from PubChem (CID 145197743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).