C12H22N2 — CID 146207418
6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine (PubChem CID 146207418) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine.
| Compound Name | 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine |
|---|---|
| PubChem CID | 146207418 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine |
| SMILES | [H]/N=C/C1CC(C(C)C)C(C)C=C1NC |
| InChI | InChI=1S/C12H22N2/c1-8(2)11-6-10(7-13)12(14-4)5-9(11)3/h5,7-11,13-14H,6H2,1-4H3/b13-7+ |
| InChIKey | YKSUHSGYEMIQOC-NTUHNPAUSA-N |
| XLogP | 2.67 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|