About 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine
6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine (PubChem CID 146207418) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine.
Molecular Properties
| Compound Name | 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine |
| PubChem CID | 146207418 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine |
| SMILES | [H]/N=C/C1CC(C(C)C)C(C)C=C1NC |
| InChI | InChI=1S/C12H22N2/c1-8(2)11-6-10(7-13)12(14-4)5-9(11)3/h5,7-11,13-14H,6H2,1-4H3/b13-7+ |
| InChIKey | YKSUHSGYEMIQOC-NTUHNPAUSA-N |
| XLogP | 2.67 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine?
The IUPAC name of 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine (CID 146207418) is 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine.
What is the SMILES notation for 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine?
The canonical SMILES for 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine is [H]/N=C/C1CC(C(C)C)C(C)C=C1NC.
What is the InChIKey of 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine?
The InChIKey is YKSUHSGYEMIQOC-NTUHNPAUSA-N. The full InChI is InChI=1S/C12H22N2/c1-8(2)11-6-10(7-13)12(14-4)5-9(11)3/h5,7-11,13-14H,6H2,1-4H3/b13-7+.
What are the key properties of 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine?
6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine has a molecular weight of 194.32 g/mol, XLogP of 2.67, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methanimidoyl-N,3-dimethyl-4-propan-2-ylcyclohexen-1-amine is sourced from PubChem (CID 146207418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).