C15H30N2 — CID 91119275
(Z)-N,2,2,4-tetramethyl-7-(propylideneamino)oct-6-en-4-amine (PubChem CID 91119275) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is (Z)-N,2,2,4-tetramethyl-7-(propylideneamino)oct-6-en-4-amine.
| Compound Name | (Z)-N,2,2,4-tetramethyl-7-(propylideneamino)oct-6-en-4-amine |
|---|---|
| PubChem CID | 91119275 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | (Z)-N,2,2,4-tetramethyl-7-(propylideneamino)oct-6-en-4-amine |
| SMILES | CC/C=N/C(C)=C\CC(C)(CC(C)(C)C)NC |
| InChI | InChI=1S/C15H30N2/c1-8-11-17-13(2)9-10-15(6,16-7)12-14(3,4)5/h9,11,16H,8,10,12H2,1-7H3/b13-9-,17-11+ |
| InChIKey | UDRJODFPYITHCF-BMWMMMPHSA-N |
| XLogP | 4.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|