C10H19N2+ — CID 5179436
[5,5-dimethyl-3-(methylamino)cyclohex-2-en-1-ylidene]-methylazanium (PubChem CID 5179436) has the molecular formula C10H19N2+ and a molecular weight of 167.28 g/mol. Its IUPAC name is [5,5-dimethyl-3-(methylamino)cyclohex-2-en-1-ylidene]-methylazanium.
| Compound Name | [5,5-dimethyl-3-(methylamino)cyclohex-2-en-1-ylidene]-methylazanium |
|---|---|
| PubChem CID | 5179436 |
| Molecular Formula | C10H19N2+ |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | [5,5-dimethyl-3-(methylamino)cyclohex-2-en-1-ylidene]-methylazanium |
| SMILES | CNC1=C/C(=[NH+]\C)CC(C)(C)C1 |
| InChI | InChI=1S/C10H18N2/c1-10(2)6-8(11-3)5-9(7-10)12-4/h5,11H,6-7H2,1-4H3/p+1/b12-9+ |
| InChIKey | OZGLSVGOXBCGCP-FMIVXFBMSA-O |
| XLogP | 0.06 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|