C11H21N — CID 143568027
4,4-diethyl-N-methylcyclohexen-1-amine (PubChem CID 143568027) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 4,4-diethyl-N-methylcyclohexen-1-amine.
| Compound Name | 4,4-diethyl-N-methylcyclohexen-1-amine |
|---|---|
| PubChem CID | 143568027 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 4,4-diethyl-N-methylcyclohexen-1-amine |
| SMILES | CCC1(CC)CC=C(NC)CC1 |
| InChI | InChI=1S/C11H21N/c1-4-11(5-2)8-6-10(12-3)7-9-11/h6,12H,4-5,7-9H2,1-3H3 |
| InChIKey | JCFNLUXIKVGPML-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |