C11H17N — CID 23598528
9-azaspiro[5.6]dodeca-4,10-diene (PubChem CID 23598528) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 9-azaspiro[5.6]dodeca-4,10-diene.
| Compound Name | 9-azaspiro[5.6]dodeca-4,10-diene |
|---|---|
| PubChem CID | 23598528 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 9-azaspiro[5.6]dodeca-4,10-diene |
| SMILES | C1=CC2(CC=CNCC2)CCC1 |
| InChI | InChI=1S/C11H17N/c1-2-5-11(6-3-1)7-4-9-12-10-8-11/h2,4-5,9,12H,1,3,6-8,10H2 |
| InChIKey | UKOBNXADTIFCQM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|