C13H27N3 — CID 144740227
(E)-4-methylimino-4-piperidin-4-ylbut-2-en-2-amine;propane (PubChem CID 144740227) has the molecular formula C13H27N3 and a molecular weight of 225.38 g/mol. Its IUPAC name is (E)-4-methylimino-4-piperidin-4-ylbut-2-en-2-amine;propane.
| Compound Name | (E)-4-methylimino-4-piperidin-4-ylbut-2-en-2-amine;propane |
|---|---|
| PubChem CID | 144740227 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | (E)-4-methylimino-4-piperidin-4-ylbut-2-en-2-amine;propane |
| SMILES | C/N=C(\C=C(/C)N)C1CCNCC1.CCC |
| InChI | InChI=1S/C10H19N3.C3H8/c1-8(11)7-10(12-2)9-3-5-13-6-4-9;1-3-2/h7,9,13H,3-6,11H2,1-2H3;3H2,1-2H3/b8-7+,12-10+; |
| InChIKey | XDHHJUVOLLATBY-QFWHUFFFSA-N |
| XLogP | 2.34 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|