C14H27N2+ — CID 91407704
(Z)-N-butyl-5-ethyl-7-imino-6-methylhept-3-en-4-amine (PubChem CID 91407704) has the molecular formula C14H27N2+ and a molecular weight of 223.38 g/mol. Its IUPAC name is (Z)-N-butyl-5-ethyl-7-imino-6-methylhept-3-en-4-amine.
| Compound Name | (Z)-N-butyl-5-ethyl-7-imino-6-methylhept-3-en-4-amine |
|---|---|
| PubChem CID | 91407704 |
| Molecular Formula | C14H27N2+ |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.22 |
| IUPAC Name | (Z)-N-butyl-5-ethyl-7-imino-6-methylhept-3-en-4-amine |
| SMILES | [H]/N=C/C(C)C(CC)/C(=C/CC)NCC[CH+]C |
| InChI | InChI=1S/C14H27N2/c1-5-8-10-16-14(9-6-2)13(7-3)12(4)11-15/h5,9,11-13,15-16H,6-8,10H2,1-4H3/q+1/b14-9-,15-11+ |
| InChIKey | CLRSCAZNSIOPLT-GNESMGCMSA-N |
| XLogP | 3.80 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|