C10H16N2 — CID 142892723
6-piperidin-4-yl-3,4-dihydropyridine (PubChem CID 142892723) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 6-piperidin-4-yl-3,4-dihydropyridine.
| Compound Name | 6-piperidin-4-yl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 142892723 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 6-piperidin-4-yl-3,4-dihydropyridine |
| SMILES | C1=NC(C2CCNCC2)=CCC1 |
| InChI | InChI=1S/C10H16N2/c1-2-6-12-10(3-1)9-4-7-11-8-5-9/h3,6,9,11H,1-2,4-5,7-8H2 |
| InChIKey | LGEDGJDDHQEZJG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |