C12H21N — CID 143661058
6-heptan-3-yl-3,4-dihydropyridine (PubChem CID 143661058) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 6-heptan-3-yl-3,4-dihydropyridine.
| Compound Name | 6-heptan-3-yl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 143661058 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 6-heptan-3-yl-3,4-dihydropyridine |
| SMILES | CCCCC(CC)C1=CCCC=N1 |
| InChI | InChI=1S/C12H21N/c1-3-5-8-11(4-2)12-9-6-7-10-13-12/h9-11H,3-8H2,1-2H3 |
| InChIKey | GONDXVCJYIQPNP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |