C12H16FN — CID 144727290
3-(3-fluorohexa-1,5-dien-3-yl)-6-methyl-3,4-dihydropyridine (PubChem CID 144727290) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is 3-(3-fluorohexa-1,5-dien-3-yl)-6-methyl-3,4-dihydropyridine.
| Compound Name | 3-(3-fluorohexa-1,5-dien-3-yl)-6-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 144727290 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 3-(3-fluorohexa-1,5-dien-3-yl)-6-methyl-3,4-dihydropyridine |
| SMILES | C=CCC(F)(C=C)C1C=NC(C)=CC1 |
| InChI | InChI=1S/C12H16FN/c1-4-8-12(13,5-2)11-7-6-10(3)14-9-11/h4-6,9,11H,1-2,7-8H2,3H3 |
| InChIKey | AMSAWXUCCWZGJE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|