C14H27N — CID 143574724
6-tert-butyl-3-propan-2-yl-3,4-dihydropyridine;ethane (PubChem CID 143574724) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 6-tert-butyl-3-propan-2-yl-3,4-dihydropyridine;ethane.
| Compound Name | 6-tert-butyl-3-propan-2-yl-3,4-dihydropyridine;ethane |
|---|---|
| PubChem CID | 143574724 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 6-tert-butyl-3-propan-2-yl-3,4-dihydropyridine;ethane |
| SMILES | CC.CC(C)C1C=NC(C(C)(C)C)=CC1 |
| InChI | InChI=1S/C12H21N.C2H6/c1-9(2)10-6-7-11(13-8-10)12(3,4)5;1-2/h7-10H,6H2,1-5H3;1-2H3 |
| InChIKey | BONWIFSFIBCYPR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |