C15H27N — CID 54387990
3,5-dimethyl-6-octyl-3,4-dihydropyridine (PubChem CID 54387990) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 3,5-dimethyl-6-octyl-3,4-dihydropyridine.
| Compound Name | 3,5-dimethyl-6-octyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 54387990 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 3,5-dimethyl-6-octyl-3,4-dihydropyridine |
| SMILES | CCCCCCCCC1=C(C)CC(C)C=N1 |
| InChI | InChI=1S/C15H27N/c1-4-5-6-7-8-9-10-15-14(3)11-13(2)12-16-15/h12-13H,4-11H2,1-3H3 |
| InChIKey | VEQBXPLMRDKUSK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|