About 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine
5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine (PubChem CID 89185960) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine.
Analyze 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine?
The IUPAC name of 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine (CID 89185960) is 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine.
What is the SMILES notation for 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine?
The canonical SMILES for 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine is CC1CCC2=C1CCC=N2.
What is the InChIKey of 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine?
The InChIKey is RDEAHGDWKVVHLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-7-4-5-9-8(7)3-2-6-10-9/h6-7H,2-5H2,1H3.
What are the key properties of 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine?
5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine has a molecular weight of 135.21 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,5,6,7-tetrahydro-3H-cyclopenta[b]pyridine is sourced from PubChem (CID 89185960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).